CAS 2229448-80-8 appears in our catalog under these names: 1–((1,1'–biphenyl)–2–yl)–2,2–difluorocyclopropane–1–carboxylic acid, 2,2-difluoro-1-(2-phenylphenyl)cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 500mg, 5g.
2,2-difluoro-1-(2-phenylphenyl)cyclopropane-1-carboxylic acid (CAS 2229448-80-8) is a chemical compound with the molecular formula C16H12F2O2 and a molecular weight of 274.26 g/mol. IUPAC name: 2,2-difluoro-1-(2-phenylphenyl)cyclopropane-1-carboxylic acid. InChIKey: WVJSHJSHYRUJGF-UHFFFAOYSA-N.
| Molecular formula | C16H12F2O2 |
|---|---|
| Molecular weight | 274.26 g/mol |
| IUPAC name | 2,2-difluoro-1-(2-phenylphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | WVJSHJSHYRUJGF-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(C2=CC=CC=C2C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)