Products 2229533-86-0
CAS 2229533-86-0 appears in our catalog under these names: 2，2–difluoro–1–(4–(trifluoromethoxy)phenyl)cyclopropane–1–carboxylic acid, 2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 500mg, 5g.
2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid (CAS 2229533-86-0) is a chemical compound with the molecular formula C11H7F5O3 and a molecular weight of 282.16 g/mol. IUPAC name: 2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid. InChIKey: CCFGYKUWJUXGIQ-UHFFFAOYSA-N.
| Molecular formula | C11H7F5O3 |
|---|---|
| Molecular weight | 282.16 g/mol |
| IUPAC name | 2,2-difluoro-1-[4-(trifluoromethoxy)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | CCFGYKUWJUXGIQ-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(C2=CC=C(C=C2)OC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)