CAS 2229554-37-2 is the registry number for 1-(3-Ethynylphenyl)-2,2,2-trifluoroethan-1-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(3-ethynylphenyl)-2,2,2-trifluoroethanone (CAS 2229554-37-2) is a chemical compound with the molecular formula C10H5F3O and a molecular weight of 198.14 g/mol. IUPAC name: 1-(3-ethynylphenyl)-2,2,2-trifluoroethanone. InChIKey: NPFMUAPPJSUOJY-UHFFFAOYSA-N.
| Molecular formula | C10H5F3O |
|---|---|
| Molecular weight | 198.14 g/mol |
| IUPAC name | 1-(3-ethynylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | NPFMUAPPJSUOJY-UHFFFAOYSA-N |
| SMILES | C#CC1=CC(=CC=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)