Products 222966-66-7
CAS 222966-66-7 is the registry number for alpha-HCH 13C6 100 µg/mL in Cyclohexane. Offered by: Dr. Ehrenstorfer. Available pack sizes: 1ml.
1,2,3,4,5,6-hexachloro(1,2,3,4,5,6-13C6)cyclohexane (CAS 222966-66-7) is a chemical compound with the molecular formula C6H6Cl6 and a molecular weight of 296.8 g/mol. IUPAC name: 1,2,3,4,5,6-hexachloro(1,2,3,4,5,6-13C6)cyclohexane. InChIKey: JLYXXMFPNIAWKQ-IDEBNGHGSA-N.
| Molecular formula | C6H6Cl6 |
|---|---|
| Molecular weight | 296.8 g/mol |
| IUPAC name | 1,2,3,4,5,6-hexachloro(1,2,3,4,5,6-13C6)cyclohexane |
| InChIKey | JLYXXMFPNIAWKQ-IDEBNGHGSA-N |
| SMILES | [13CH]1([13CH]([13CH]([13CH]([13CH]([13CH]1Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
gamma-Lindane-13C6, (+/-)-alpha-BHC-13C6, 1,2,3,4,5,6-hexachloro(1,2,3,4,5,6-13C6)cyclohexane, alpha-1,2,3,4,5,6-Hexachlorocyclohexane-13C6, Cyclohexane-13C6, 1,2,3,4,5,6-hexachloro-, (1?,2?,3?,4?,5?,6?)-, Lin Dan-13C6 (gamma-BHC), alpha-HCH 13C6 100 |Ig/mL in Cyclohexane, alpha-HCH 13C6 100 microg/mL in Cyclohexane, Lindane-13C6 (gamma-BHC), 99 atom % 13C, Alpha-1,2,3,4,5,6-Hexachlorocyclohexane-13C6 (>90%)