Products 2229723-83-3
CAS 2229723-83-3 is the registry number for Desamino lenalidomide-2,6-diazaspiro[3.3]heptane. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2229723-83-3) is a chemical compound with the molecular formula C18H20N4O3 and a molecular weight of 340.4 g/mol. IUPAC name: 3-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: BLDYYRSRJPPNSG-UHFFFAOYSA-N.
| Molecular formula | C18H20N4O3 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 3-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | BLDYYRSRJPPNSG-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=CC(=C3)N4CC5(C4)CNC5 |
Computed by PubChem (NCBI)