CAS 2229724-20-1 is the registry number for E3 Ligase Ligand-linker Conjugate 141. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S)-3-[6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (CAS 2229724-20-1) is a chemical compound with the molecular formula C20H24N4O3 and a molecular weight of 368.4 g/mol. IUPAC name: (3S)-3-[6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione. InChIKey: CMUYBPMCSWFBSY-INIZCTEOSA-N.
| Molecular formula | C20H24N4O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | (3S)-3-[6-(2,7-diazaspiro[3.5]nonan-2-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| InChIKey | CMUYBPMCSWFBSY-INIZCTEOSA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=C(C2=O)C=CC(=C3)N4CC5(C4)CCNCC5 |
Computed by PubChem (NCBI)