CAS 94758-81-3 appears in our catalog under these names: 4'–hydroxy Nitazene, 4'-Hydroxy nitazene. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg.
4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenol (CAS 94758-81-3) is a chemical compound with the molecular formula C20H24N4O3 and a molecular weight of 368.4 g/mol. IUPAC name: 4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenol. InChIKey: KWJGAOHXZYKBKR-UHFFFAOYSA-N.
| Molecular formula | C20H24N4O3 |
|---|---|
| Molecular weight | 368.4 g/mol |
| IUPAC name | 4-[[1-[2-(diethylamino)ethyl]-5-nitrobenzimidazol-2-yl]methyl]phenol |
| InChIKey | KWJGAOHXZYKBKR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CC3=CC=C(C=C3)O |
Computed by PubChem (NCBI)