CAS 2229861-17-8 appears in our catalog under these names: Elexacaftor Impurity 2 , 2-Chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)-1H-pyrazol-1-yl]-3-pyridinecarboxylic acid, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylic acid (CAS 2229861-17-8) is a chemical compound with the molecular formula C14H13ClF3N3O3 and a molecular weight of 363.72 g/mol. IUPAC name: 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylic acid. InChIKey: IHSUNZLVJQDZGP-UHFFFAOYSA-N.
| Molecular formula | C14H13ClF3N3O3 |
|---|---|
| Molecular weight | 363.72 g/mol |
| IUPAC name | 2-chloro-6-[3-(3,3,3-trifluoro-2,2-dimethylpropoxy)pyrazol-1-yl]pyridine-3-carboxylic acid |
| InChIKey | IHSUNZLVJQDZGP-UHFFFAOYSA-N |
| SMILES | CC(C)(COC1=NN(C=C1)C2=NC(=C(C=C2)C(=O)O)Cl)C(F)(F)F |
Computed by PubChem (NCBI)