CAS 2230016-26-7 appears in our catalog under these names: Mal–PEG3–C1–NHS ester, Mal-PEG3-C1-NHS ester 95%, Mal-PEG3-C1-NHS ester, 95.0%. Offered by: GLPBio, Ambeed, MedChemExpress. Available pack sizes: 100mg, 1g, 250mg, 500mg, 25 mg (260.19 mM * 250 μL in DMSO), 5 mg (260.19 mM * 50 μL in DMSO), 10 mg (260.19 mM * 100 μL in DMSO), 50 mg (260.19 mM * 500 μL in DMSO).
(2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]acetate (CAS 2230016-26-7) is a chemical compound with the molecular formula C16H20N2O9 and a molecular weight of 384.34 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]acetate. InChIKey: FZNJNZTVSYYDPI-UHFFFAOYSA-N.
| Molecular formula | C16H20N2O9 |
|---|---|
| Molecular weight | 384.34 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]acetate |
| InChIKey | FZNJNZTVSYYDPI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)COCCOCCOCCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)