Products 2230200-26-5

CAS 2230200-26-5 is the registry number for 1-(tert-Butyl) 4-methyl 4-(6-chloropyridin-2-yl)piperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-methyl 4-(6-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate (CAS 2230200-26-5) is a chemical compound with the molecular formula C17H23ClN2O4 and a molecular weight of 354.8 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 4-(6-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate. InChIKey: VRLNOXRCNGNLDC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H23ClN2O4
Molecular weight354.8 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 4-(6-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate
InChIKeyVRLNOXRCNGNLDC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)(C2=NC(=CC=C2)Cl)C(=O)OC

Computed by PubChem (NCBI)