CAS 22303-34-0 is the registry number for 2-Chloro-N-(2,4,6-trichloro-phenyl)-acetamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-chloro-N-(2,4,6-trichlorophenyl)acetamide (CAS 22303-34-0) is a chemical compound with the molecular formula C8H5Cl4NO and a molecular weight of 272.9 g/mol. IUPAC name: 2-chloro-N-(2,4,6-trichlorophenyl)acetamide. InChIKey: PXPBIOJVDMLMKK-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl4NO |
|---|---|
| Molecular weight | 272.9 g/mol |
| IUPAC name | 2-chloro-N-(2,4,6-trichlorophenyl)acetamide |
| InChIKey | PXPBIOJVDMLMKK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)NC(=O)CCl)Cl)Cl |
Computed by PubChem (NCBI)