CAS 2230674-05-0 is the registry number for N2-(Methylsulfonyl)-N2-trityl-L-glutamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-5-amino-2-[methylsulfonyl(trityl)amino]-5-oxopentanoic acid (CAS 2230674-05-0) is a chemical compound with the molecular formula C25H26N2O5S and a molecular weight of 466.6 g/mol. IUPAC name: (2S)-5-amino-2-[methylsulfonyl(trityl)amino]-5-oxopentanoic acid. InChIKey: ATESJIHBSNPFPA-QFIPXVFZSA-N.
| Molecular formula | C25H26N2O5S |
|---|---|
| Molecular weight | 466.6 g/mol |
| IUPAC name | (2S)-5-amino-2-[methylsulfonyl(trityl)amino]-5-oxopentanoic acid |
| InChIKey | ATESJIHBSNPFPA-QFIPXVFZSA-N |
| SMILES | CS(=O)(=O)N([C@@H](CCC(=O)N)C(=O)O)C(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)