Products 2230724-46-4
CAS 2230724-46-4 is the registry number for DiZHSeC, 99.90%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 1 mg, 10 mg.
(2S)-2-amino-4-[3-[3-(3-methyldiazirin-3-yl)propylamino]-3-oxopropyl]selanylbutanoic acid (CAS 2230724-46-4) is a chemical compound with the molecular formula C12H22N4O3Se and a molecular weight of 349.30 g/mol. IUPAC name: (2S)-2-amino-4-[3-[3-(3-methyldiazirin-3-yl)propylamino]-3-oxopropyl]selanylbutanoic acid. InChIKey: KPYJXSFGJYEMAU-VIFPVBQESA-N.
| Molecular formula | C12H22N4O3Se |
|---|---|
| Molecular weight | 349.30 g/mol |
| IUPAC name | (2S)-2-amino-4-[3-[3-(3-methyldiazirin-3-yl)propylamino]-3-oxopropyl]selanylbutanoic acid |
| InChIKey | KPYJXSFGJYEMAU-VIFPVBQESA-N |
| SMILES | CC1(N=N1)CCCNC(=O)CC[Se]CC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
DiZHSeC, orb2566402