CAS 22308-12-9 appears in our catalog under these names: 1,3-Bis(tosyloxy)-2,2-dimethylpropane, 98%, 1,3–Bis(tosyloxy)–2,2–dimethylpropane, 1,3-Bis(tosyloxy)-2,2-dimethylpropane, >98.0%(GC), 1,3-Bis(tosyloxy)-2,2-dimethylpropane 98%, 1,3-Bis(tosyloxy)-2,2-dimethylpropane, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 10g.
[2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate (CAS 22308-12-9) is a chemical compound with the molecular formula C19H24O6S2 and a molecular weight of 412.5 g/mol. IUPAC name: [2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate. InChIKey: LJISGCCLDDOYIJ-UHFFFAOYSA-N.
| Molecular formula | C19H24O6S2 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | [2,2-dimethyl-3-(4-methylphenyl)sulfonyloxypropyl] 4-methylbenzenesulfonate |
| InChIKey | LJISGCCLDDOYIJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(C)(C)COS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)