Products 2230803-38-8
CAS 2230803-38-8 is the registry number for 3-Amino-1-thiaspiro(3.5)nonan-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-amino-1-thiaspiro[3.5]nonan-2-one;hydrochloride (CAS 2230803-38-8) is a chemical compound with the molecular formula C8H14ClNOS and a molecular weight of 207.72 g/mol. IUPAC name: 3-amino-1-thiaspiro[3.5]nonan-2-one;hydrochloride. InChIKey: MDDVYSAQOZAMFF-UHFFFAOYSA-N.
| Molecular formula | C8H14ClNOS |
|---|---|
| Molecular weight | 207.72 g/mol |
| IUPAC name | 3-amino-1-thiaspiro[3.5]nonan-2-one;hydrochloride |
| InChIKey | MDDVYSAQOZAMFF-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(C(=O)S2)N.Cl |
Computed by PubChem (NCBI)