Products 2230804-15-4

CAS 2230804-15-4 is the registry number for 1-(1,3-Thiazol-4-yl)bicyclo(2.1.1)hexane-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-(1,3-thiazol-4-yl)bicyclo[2.1.1]hexane-5-carboxylic acid (CAS 2230804-15-4) is a chemical compound with the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. IUPAC name: 1-(1,3-thiazol-4-yl)bicyclo[2.1.1]hexane-5-carboxylic acid. InChIKey: UQJRFGJNASFIBU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11NO2S
Molecular weight209.27 g/mol
IUPAC name1-(1,3-thiazol-4-yl)bicyclo[2.1.1]hexane-5-carboxylic acid
InChIKeyUQJRFGJNASFIBU-UHFFFAOYSA-N
SMILESC1CC2(CC1C2C(=O)O)C3=CSC=N3

Computed by PubChem (NCBI)