Products 2230807-06-2
CAS 2230807-06-2 appears in our catalog under these names: Rel-(1R,4S,6R)-2-azabicyclo(2.2.1)heptan-6-ol hydrochloride, 97%, rac-(1R,4S,6R)-2-Azabicyclo(2.2.1)heptan-6-ol hydrochloride, RAC-(1R,4S,6R)-2-AZABICYCLO[2.2.1]HEPTAN-6-OL HYDROCHLORIDE, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 10g, 5g, 100mg, 1g, 250mg, 500mg.
(1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride (CAS 2230807-06-2) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride. InChIKey: HTTUWXPQGHCWCO-FPKZOZHISA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1R,4S,6R)-2-azabicyclo[2.2.1]heptan-6-ol;hydrochloride |
| InChIKey | HTTUWXPQGHCWCO-FPKZOZHISA-N |
| SMILES | C1[C@H]2C[C@H]([C@@H]1NC2)O.Cl |
Computed by PubChem (NCBI)