Products 2230887-17-7
CAS 2230887-17-7 appears in our catalog under these names: N-Acetyl-L-serine-2,3,3-d3, >95% (HPLC), N-Acetyl-L-serine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, N-Acetylserine-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 0,5mg, 1mg, 5mg, 0,05g, 0,01g, 1 mg, 5 mg, 500 μg.
(2S)-2-acetamido-2,3,3-trideuterio-3-hydroxypropanoic acid (CAS 2230887-17-7) is a chemical compound with the molecular formula C5H9NO4 and a molecular weight of 150.15 g/mol. IUPAC name: (2S)-2-acetamido-2,3,3-trideuterio-3-hydroxypropanoic acid. InChIKey: JJIHLJJYMXLCOY-BWBLNMPZSA-N.
| Molecular formula | C5H9NO4 |
|---|---|
| Molecular weight | 150.15 g/mol |
| IUPAC name | (2S)-2-acetamido-2,3,3-trideuterio-3-hydroxypropanoic acid |
| InChIKey | JJIHLJJYMXLCOY-BWBLNMPZSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])O)NC(=O)C |
Computed by PubChem (NCBI)