CAS 2230887-18-8 appears in our catalog under these names: N-Acetyl-L-alanine-2,3,3,3-d4, >95% (HPLC), N-Acetyl-L-alanine-2,3,3,3-d4, 98 atom % D, min 98% Chemical Purity, Ac-Ala-OH-d4. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 0,1g, 0,05g, 10 mg.
2-acetamido-2,3,3,3-tetradeuteriopropanoic acid (CAS 2230887-18-8) is a chemical compound with the molecular formula C5H9NO3 and a molecular weight of 135.15 g/mol. IUPAC name: 2-acetamido-2,3,3,3-tetradeuteriopropanoic acid. InChIKey: KTHDTJVBEPMMGL-VYMTUXDUSA-N.
| Molecular formula | C5H9NO3 |
|---|---|
| Molecular weight | 135.15 g/mol |
| IUPAC name | 2-acetamido-2,3,3,3-tetradeuteriopropanoic acid |
| InChIKey | KTHDTJVBEPMMGL-VYMTUXDUSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)