CAS 2230912-20-4 appears in our catalog under these names: Rel-(1R,4R,5R)-2-azabicyclo(2.2.1)heptan-5-ol hydrochloride, 97%, endo-2-azabicyclo[2.2.1]heptan-5-ol,hydrochloride, 95%, 95%, RAC-(1S,4S,5S)-2-AZABICYCLO[2.2.1]HEPTAN-5-OL HYDROCHLORIDE, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
(1S,4S,5S)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride (CAS 2230912-20-4) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: (1S,4S,5S)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride. InChIKey: LUTVSQCTGHUTOO-YCLXABBFSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | (1S,4S,5S)-2-azabicyclo[2.2.1]heptan-5-ol;hydrochloride |
| InChIKey | LUTVSQCTGHUTOO-YCLXABBFSA-N |
| SMILES | C1[C@H]2C[C@@H]([C@@H]1CN2)O.Cl |
Computed by PubChem (NCBI)