Products 2230913-58-1
CAS 2230913-58-1 is the registry number for rac-(1R,3S)-N1,N1-Dimethylcyclopentane-1,3-diamine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Cis-(1S,3R)-3-N,3-N-dimethylcyclopentane-1,3-diamine;dihydrochloride (CAS 2230913-58-1) is a chemical compound with the molecular formula C7H18Cl2N2 and a molecular weight of 201.13 g/mol. IUPAC name: cis-(1S,3R)-3-N,3-N-dimethylcyclopentane-1,3-diamine;dihydrochloride. InChIKey: GUBSGFSIPMXYIP-AUCRBCQYSA-N.
| Molecular formula | C7H18Cl2N2 |
|---|---|
| Molecular weight | 201.13 g/mol |
| IUPAC name | cis-(1S,3R)-3-N,3-N-dimethylcyclopentane-1,3-diamine;dihydrochloride |
| InChIKey | GUBSGFSIPMXYIP-AUCRBCQYSA-N |
| SMILES | CN(C)[C@@H]1CC[C@@H](C1)N.Cl.Cl |
Computed by PubChem (NCBI)