CAS 2230962-93-1 is the registry number for 6,6-Dimethyl-2,4,6,7-tetrahydro-5H-pyrazolo[3,4-b]pyrazin-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,6-dimethyl-4,7-dihydro-1H-pyrazolo[4,5-b]pyrazin-5-one (CAS 2230962-93-1) is a chemical compound with the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. IUPAC name: 6,6-dimethyl-4,7-dihydro-1H-pyrazolo[4,5-b]pyrazin-5-one. InChIKey: PSTPXRXTTGZTRS-UHFFFAOYSA-N.
| Molecular formula | C7H10N4O |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 6,6-dimethyl-4,7-dihydro-1H-pyrazolo[4,5-b]pyrazin-5-one |
| InChIKey | PSTPXRXTTGZTRS-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(N1)NN=C2)C |
Computed by PubChem (NCBI)