Products 2231142-90-6
CAS 2231142-90-6 appears in our catalog under these names: Fulimetibant, Fulimetibant, 99.60%, Fulimetibant, 99.74%. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mM (in 1ml dmso), 5 mg, 100 mg, 10 mg, 50 mg, 10mM/1mL.
2-(1-cyclobutylpyrazol-4-yl)-5-[[1-[2-fluoro-4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzoic acid (CAS 2231142-90-6) is a chemical compound with the molecular formula C25H21F4N3O3 and a molecular weight of 487.4 g/mol. IUPAC name: 2-(1-cyclobutylpyrazol-4-yl)-5-[[1-[2-fluoro-4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzoic acid. InChIKey: DFQFSWDEFZCQLH-UHFFFAOYSA-N.
| Molecular formula | C25H21F4N3O3 |
|---|---|
| Molecular weight | 487.4 g/mol |
| IUPAC name | 2-(1-cyclobutylpyrazol-4-yl)-5-[[1-[2-fluoro-4-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]benzoic acid |
| InChIKey | DFQFSWDEFZCQLH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)N2C=C(C=N2)C3=C(C=C(C=C3)NC(=O)C4(CC4)C5=C(C=C(C=C5)C(F)(F)F)F)C(=O)O |
Computed by PubChem (NCBI)