CAS 2231418-79-2 is the registry number for 2'-Methyl-[1,1':3',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-[3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid (CAS 2231418-79-2) is a chemical compound with the molecular formula C23H16O8 and a molecular weight of 420.4 g/mol. IUPAC name: 5-[3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid. InChIKey: JKYUOVPYLXEVDF-UHFFFAOYSA-N.
| Molecular formula | C23H16O8 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 5-[3-(3,5-dicarboxyphenyl)-2-methylphenyl]benzene-1,3-dicarboxylic acid |
| InChIKey | JKYUOVPYLXEVDF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)