Products 2231418-80-5

CAS 2231418-80-5 is the registry number for 4'-Methyl-[1,1':3',1''-terphenyl]-3,3'',5,5''-tetracarboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-[3-(3,5-dicarboxyphenyl)-4-methylphenyl]benzene-1,3-dicarboxylic acid (CAS 2231418-80-5) is a chemical compound with the molecular formula C23H16O8 and a molecular weight of 420.4 g/mol. IUPAC name: 5-[3-(3,5-dicarboxyphenyl)-4-methylphenyl]benzene-1,3-dicarboxylic acid. InChIKey: BBITWBXVVOKKLL-UHFFFAOYSA-N.

Identity
Molecular formulaC23H16O8
Molecular weight420.4 g/mol
IUPAC name5-[3-(3,5-dicarboxyphenyl)-4-methylphenyl]benzene-1,3-dicarboxylic acid
InChIKeyBBITWBXVVOKKLL-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=CC(=CC(=C2)C(=O)O)C(=O)O)C3=CC(=CC(=C3)C(=O)O)C(=O)O

Computed by PubChem (NCBI)