Products 2231665-02-2
CAS 2231665-02-2 is the registry number for ethyl (2S)-2-(4-oxocyclohexyl)propanoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Ethyl (2S)-2-(4-oxocyclohexyl)propanoate (CAS 2231665-02-2) is a chemical compound with the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. IUPAC name: ethyl (2S)-2-(4-oxocyclohexyl)propanoate. InChIKey: RRUJMJLHOSVNCM-QMMMGPOBSA-N.
| Molecular formula | C11H18O3 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | ethyl (2S)-2-(4-oxocyclohexyl)propanoate |
| InChIKey | RRUJMJLHOSVNCM-QMMMGPOBSA-N |
| SMILES | CCOC(=O)[C@@H](C)C1CCC(=O)CC1 |
Computed by PubChem (NCBI)