CAS 2231666-40-1 appears in our catalog under these names: (1R,4R)-2-Thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide hydrochloride, 95%, (1R,4R)-2-Thia-5-azabicyclo(2.2.1)heptane 2,2-dioxide dihydrochloride, 97%, (1R,4R)-2-Thia-5-azabicyclo(2.2.1)heptane 2,2-dioxide hydrochloride, (1R,4R)-2λ⁶-thia-5-azabicyclo[2.2.1]heptane-2,2-dione hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g, 0,5g, 50mg, 500mg.
(1R,4R)-2lambda6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide;hydrochloride (CAS 2231666-40-1) is a chemical compound with the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. IUPAC name: (1R,4R)-2lambda6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide;hydrochloride. InChIKey: CCLLUNMSIFQAIP-TYSVMGFPSA-N.
| Molecular formula | C5H10ClNO2S |
|---|---|
| Molecular weight | 183.66 g/mol |
| IUPAC name | (1R,4R)-2lambda6-thia-5-azabicyclo[2.2.1]heptane 2,2-dioxide;hydrochloride |
| InChIKey | CCLLUNMSIFQAIP-TYSVMGFPSA-N |
| SMILES | C1[C@@H]2CN[C@H]1CS2(=O)=O.Cl |
Computed by PubChem (NCBI)