CAS 2231670-11-2 is the registry number for (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane,hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
(1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride (CAS 2231670-11-2) is a chemical compound with the molecular formula C5H9ClFNO and a molecular weight of 153.58 g/mol. IUPAC name: (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride. InChIKey: RPAVWZQYNNPQKX-NAJHURIASA-N.
| Molecular formula | C5H9ClFNO |
|---|---|
| Molecular weight | 153.58 g/mol |
| IUPAC name | (1R,4R)-7-fluoro-2-oxa-5-azabicyclo[2.2.1]heptane;hydrochloride |
| InChIKey | RPAVWZQYNNPQKX-NAJHURIASA-N |
| SMILES | C1[C@@H]2C([C@H](N1)CO2)F.Cl |
Computed by PubChem (NCBI)