CAS 2231673-03-1 is the registry number for Sodium 3-methyl-1,2,4-thiadiazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Sodium 3-methyl-1,2,4-thiadiazole-5-carboxylate (CAS 2231673-03-1) is a chemical compound with the molecular formula C4H3N2NaO2S and a molecular weight of 166.14 g/mol. IUPAC name: sodium 3-methyl-1,2,4-thiadiazole-5-carboxylate. InChIKey: UDSACBCQRYHMPY-UHFFFAOYSA-M.
| Molecular formula | C4H3N2NaO2S |
|---|---|
| Molecular weight | 166.14 g/mol |
| IUPAC name | sodium 3-methyl-1,2,4-thiadiazole-5-carboxylate |
| InChIKey | UDSACBCQRYHMPY-UHFFFAOYSA-M |
| SMILES | CC1=NSC(=N1)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)