Products 2231673-18-8

CAS 2231673-18-8 is the registry number for 5-chloro-6-fluoro-1H-pyrrolo[3,2-b]pyridine, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

5-chloro-6-fluoro-1H-pyrrolo[3,2-b]pyridine (CAS 2231673-18-8) is a chemical compound with the molecular formula C7H4ClFN2 and a molecular weight of 170.57 g/mol. IUPAC name: 5-chloro-6-fluoro-1H-pyrrolo[3,2-b]pyridine. InChIKey: IQBOPYKDZUJZTR-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4ClFN2
Molecular weight170.57 g/mol
IUPAC name5-chloro-6-fluoro-1H-pyrrolo[3,2-b]pyridine
InChIKeyIQBOPYKDZUJZTR-UHFFFAOYSA-N
SMILESC1=CNC2=CC(=C(N=C21)Cl)F

Computed by PubChem (NCBI)