CAS 2231674-25-0 appears in our catalog under these names: 2-(TRIFLUOROMETHYL)-7-AZASPIRO(3.5)NONAN-2-OL,HCL, 97%, 2-(Trifluoromethyl)-7-azaspiro(3.5)nonan-2-ol,hydrochloride, 2-(Trifluoromethyl)-7-azaspiro[3.5]nonan-2-ol hydrochloride, 97%, 97%, 2-(Trifluoromethyl)-7-azaspiro[3.5]nonan-2-ol hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
2-(trifluoromethyl)-7-azaspiro[3.5]nonan-2-ol;hydrochloride (CAS 2231674-25-0) is a chemical compound with the molecular formula C9H15ClF3NO and a molecular weight of 245.67 g/mol. IUPAC name: 2-(trifluoromethyl)-7-azaspiro[3.5]nonan-2-ol;hydrochloride. InChIKey: IBFSICSTGLCGOU-UHFFFAOYSA-N.
| Molecular formula | C9H15ClF3NO |
|---|---|
| Molecular weight | 245.67 g/mol |
| IUPAC name | 2-(trifluoromethyl)-7-azaspiro[3.5]nonan-2-ol;hydrochloride |
| InChIKey | IBFSICSTGLCGOU-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CC(C2)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)