CAS 2231674-32-9 appears in our catalog under these names: 3-(Trifluoromethyl)azetidin-3-amine dihydrochloride, 95%, 3–(Trifluoromethyl)azetidin–3–amine dihydrochloride, 3-(Trifluoromethyl)azetidin-3-amine dihydrochloride 98%, 3-(Trifluoromethyl)azetidin-3-amine dihydrochloride, 98%, 98%, 3-(Trifluoromethyl)azetidin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
3-(trifluoromethyl)azetidin-3-amine;dihydrochloride (CAS 2231674-32-9) is a chemical compound with the molecular formula C4H9Cl2F3N2 and a molecular weight of 213.03 g/mol. IUPAC name: 3-(trifluoromethyl)azetidin-3-amine;dihydrochloride. InChIKey: HDXBQSXBTCRVSB-UHFFFAOYSA-N.
| Molecular formula | C4H9Cl2F3N2 |
|---|---|
| Molecular weight | 213.03 g/mol |
| IUPAC name | 3-(trifluoromethyl)azetidin-3-amine;dihydrochloride |
| InChIKey | HDXBQSXBTCRVSB-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)