Products 2231675-25-3

CAS 2231675-25-3 is the registry number for 6-(Difluoromethyl)-3-azabicyclo[4.1.0]heptane hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

6-(difluoromethyl)-3-azabicyclo[4.1.0]heptane;hydrochloride (CAS 2231675-25-3) is a chemical compound with the molecular formula C7H12ClF2N and a molecular weight of 183.63 g/mol. IUPAC name: 6-(difluoromethyl)-3-azabicyclo[4.1.0]heptane;hydrochloride. InChIKey: AUZBLVPSWGCYQB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H12ClF2N
Molecular weight183.63 g/mol
IUPAC name6-(difluoromethyl)-3-azabicyclo[4.1.0]heptane;hydrochloride
InChIKeyAUZBLVPSWGCYQB-UHFFFAOYSA-N
SMILESC1CNCC2C1(C2)C(F)F.Cl

Computed by PubChem (NCBI)