CAS 2231843-38-0 is the registry number for N-(3-(6-Phenyldibenzo[b,d]furan-4-yl)phenyl)naphthalen-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[3-(6-phenyldibenzofuran-4-yl)phenyl]naphthalen-1-amine (CAS 2231843-38-0) is a chemical compound with the molecular formula C34H23NO and a molecular weight of 461.6 g/mol. IUPAC name: N-[3-(6-phenyldibenzofuran-4-yl)phenyl]naphthalen-1-amine. InChIKey: SNTBZZDEXWCJCT-UHFFFAOYSA-N.
| Molecular formula | C34H23NO |
|---|---|
| Molecular weight | 461.6 g/mol |
| IUPAC name | N-[3-(6-phenyldibenzofuran-4-yl)phenyl]naphthalen-1-amine |
| InChIKey | SNTBZZDEXWCJCT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC3=C2OC4=C3C=CC=C4C5=CC(=CC=C5)NC6=CC=CC7=CC=CC=C76 |
Computed by PubChem (NCBI)