CAS 2232112-69-3 is the registry number for Tropisetron Impurity 5. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1-(1H-indole-3-carbonyl)indole-3-carboxylate (CAS 2232112-69-3) is a chemical compound with the molecular formula C26H25N3O3 and a molecular weight of 427.5 g/mol. IUPAC name: [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1-(1H-indole-3-carbonyl)indole-3-carboxylate. InChIKey: LMHRLCKKTYPVTH-JWTNVVGKSA-N.
| Molecular formula | C26H25N3O3 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1-(1H-indole-3-carbonyl)indole-3-carboxylate |
| InChIKey | LMHRLCKKTYPVTH-JWTNVVGKSA-N |
| SMILES | CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)C3=CN(C4=CC=CC=C43)C(=O)C5=CNC6=CC=CC=C65 |
Computed by PubChem (NCBI)