Products 590416-75-4
CAS 590416-75-4 is the registry number for AK106-001616. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-amino-4-(2,3-dihydro-1H-inden-2-yloxy)-5-(1-methylindazol-5-yl)phenyl]propanoic acid (CAS 590416-75-4) is a chemical compound with the molecular formula C26H25N3O3 and a molecular weight of 427.5 g/mol. IUPAC name: 3-[3-amino-4-(2,3-dihydro-1H-inden-2-yloxy)-5-(1-methylindazol-5-yl)phenyl]propanoic acid. InChIKey: ULNYPYSSPODXCS-UHFFFAOYSA-N.
| Molecular formula | C26H25N3O3 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | 3-[3-amino-4-(2,3-dihydro-1H-inden-2-yloxy)-5-(1-methylindazol-5-yl)phenyl]propanoic acid |
| InChIKey | ULNYPYSSPODXCS-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C3=C(C(=CC(=C3)CCC(=O)O)N)OC4CC5=CC=CC=C5C4)C=N1 |
Computed by PubChem (NCBI)