CAS 2232877-36-8 appears in our catalog under these names: tert-Butyl 4-(difluoromethyl)-1h-pyrazole-1-carboxylate, 95%, tert–Butyl 4–(difluoromethyl)–1H–pyrazole–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.
Tert-butyl 4-(difluoromethyl)pyrazole-1-carboxylate (CAS 2232877-36-8) is a chemical compound with the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. IUPAC name: tert-butyl 4-(difluoromethyl)pyrazole-1-carboxylate. InChIKey: DZVJRCYRTLBXER-UHFFFAOYSA-N.
| Molecular formula | C9H12F2N2O2 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | tert-butyl 4-(difluoromethyl)pyrazole-1-carboxylate |
| InChIKey | DZVJRCYRTLBXER-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(C=N1)C(F)F |
Computed by PubChem (NCBI)