Products 2232877-85-7
CAS 2232877-85-7 is the registry number for KPC-2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-[(4-thiophen-3-yltriazol-1-yl)methyl]phenyl]boronic acid (CAS 2232877-85-7) is a chemical compound with the molecular formula C13H12BN3O2S and a molecular weight of 285.1 g/mol. IUPAC name: [3-[(4-thiophen-3-yltriazol-1-yl)methyl]phenyl]boronic acid. InChIKey: BPZNDAHQRPIUAE-UHFFFAOYSA-N.
| Molecular formula | C13H12BN3O2S |
|---|---|
| Molecular weight | 285.1 g/mol |
| IUPAC name | [3-[(4-thiophen-3-yltriazol-1-yl)methyl]phenyl]boronic acid |
| InChIKey | BPZNDAHQRPIUAE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CN2C=C(N=N2)C3=CSC=C3)(O)O |
Computed by PubChem (NCBI)