CAS 223416-26-0 appears in our catalog under these names: 6-Bromospiro(chromane-2,1'-cyclohexan)-4-one, 97%, 6-Bromospiro[chromane-2,1'-cyclohexan]-4-one, 98%, 98%, 6-Bromospiro[chromane-2,1'-cyclohexan]-4-one, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-one (CAS 223416-26-0) is a chemical compound with the molecular formula C14H15BrO2 and a molecular weight of 295.17 g/mol. IUPAC name: 6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-one. InChIKey: JHPXSKDBSNVNHC-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO2 |
|---|---|
| Molecular weight | 295.17 g/mol |
| IUPAC name | 6-bromospiro[3H-chromene-2,1'-cyclohexane]-4-one |
| InChIKey | JHPXSKDBSNVNHC-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)