CAS 223420-11-9 appears in our catalog under these names: Cipralisant (enantiomer), Cipralisant (enantiomer), 96%, 96%, Cipralisant (enantiomer), 96.38%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 100 mg, 10mM/1mL, 5 mg, 25 mg, 50 mg.
5-[(1S,2S)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole (CAS 223420-11-9) is a chemical compound with the molecular formula C14H20N2 and a molecular weight of 216.32 g/mol. IUPAC name: 5-[(1S,2S)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole. InChIKey: CVKJAXCQPFOAIN-RYUDHWBXSA-N.
| Molecular formula | C14H20N2 |
|---|---|
| Molecular weight | 216.32 g/mol |
| IUPAC name | 5-[(1S,2S)-2-(5,5-dimethylhex-1-ynyl)cyclopropyl]-1H-imidazole |
| InChIKey | CVKJAXCQPFOAIN-RYUDHWBXSA-N |
| SMILES | CC(C)(C)CCC#C[C@H]1C[C@@H]1C2=CN=CN2 |
Computed by PubChem (NCBI)