CAS 2234285-81-3 appears in our catalog under these names: IDH1 Inhibitor 1, 99+%, IDH1 Inhibitor 1, IDH1 Inhibitor 1, IDH1 Inhibitor 1, 99.96%, 99.96%, IDH1 Inhibitor 1, 99.96%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 10mg, 5mg, 1mg, 5 mg, 50 mg.
(4R)-4-(fluoromethyl)-3-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one (CAS 2234285-81-3) is a chemical compound with the molecular formula C20H18F4N6O2 and a molecular weight of 450.4 g/mol. IUPAC name: (4R)-4-(fluoromethyl)-3-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one. InChIKey: ULTZLMKTFYRMFK-WFASDCNBSA-N.
| Molecular formula | C20H18F4N6O2 |
|---|---|
| Molecular weight | 450.4 g/mol |
| IUPAC name | (4R)-4-(fluoromethyl)-3-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]-1,3-oxazolidin-2-one |
| InChIKey | ULTZLMKTFYRMFK-WFASDCNBSA-N |
| SMILES | C[C@@H](C1=CN(C=N1)C2=CC=C(C=C2)C(F)(F)F)NC3=NC=CC(=N3)N4[C@H](COC4=O)CF |
Computed by PubChem (NCBI)