CAS 2235-15-6 appears in our catalog under these names: 1-Acenaphthenone, >95% (HPLC), 1–Acenaphthenone, 1-Acenaphthenone, 1-Acenaphthenone, >98.0%(GC), Acenaphthylen-1(2H)-one, 98%, 98%. Offered by: TRC, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 250mg, 5g, 2g, 10g, 100g, 25g, 500mg.
2H-acenaphthylen-1-one (CAS 2235-15-6) is a chemical compound with the molecular formula C12H8O and a molecular weight of 168.19 g/mol. IUPAC name: 2H-acenaphthylen-1-one. InChIKey: JBXIOAKUBCTDES-UHFFFAOYSA-N.
| Molecular formula | C12H8O |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 2H-acenaphthylen-1-one |
| InChIKey | JBXIOAKUBCTDES-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC3=C2C(=CC=C3)C1=O |
Computed by PubChem (NCBI)