CAS 223581-77-9 is the registry number for Fmoc-L-Phe(2-NH2)-OH, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3-(2-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 223581-77-9) is a chemical compound with the molecular formula C24H22N2O4 and a molecular weight of 402.4 g/mol. IUPAC name: (2S)-3-(2-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: HTOAAPJJIYWRPF-QFIPXVFZSA-N.
| Molecular formula | C24H22N2O4 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | (2S)-3-(2-aminophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | HTOAAPJJIYWRPF-QFIPXVFZSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)N |
Computed by PubChem (NCBI)