CAS 22360-86-7 appears in our catalog under these names: 2,3-Dichloro-5-nitro-1,4-naphthoquinone, 97%, 2,3–Dichloro–5–nitro–1,4–naphthoquinone, 2,3-Dichloro-5-nitro-1,4-naphthoquinone, >97.0%(GC), 2,3-Dichloro-5-nitronaphthalene-1,4-dione, 2,3-DICHLORO-5-NITRO-1,4-NAPHTHOQUINONE, ≥97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
2,3-dichloro-5-nitronaphthalene-1,4-dione (CAS 22360-86-7) is a chemical compound with the molecular formula C10H3Cl2NO4 and a molecular weight of 272.04 g/mol. IUPAC name: 2,3-dichloro-5-nitronaphthalene-1,4-dione. InChIKey: AWCITCQRUBWCJA-UHFFFAOYSA-N.
| Molecular formula | C10H3Cl2NO4 |
|---|---|
| Molecular weight | 272.04 g/mol |
| IUPAC name | 2,3-dichloro-5-nitronaphthalene-1,4-dione |
| InChIKey | AWCITCQRUBWCJA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C(=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)