Products 223611-93-6

CAS 223611-93-6 is the registry number for Jobosic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2,5-dimethyltetradecanoic acid (CAS 223611-93-6) is a chemical compound with the molecular formula C16H32O2 and a molecular weight of 256.42 g/mol. IUPAC name: 2,5-dimethyltetradecanoic acid. InChIKey: ILOORJBAWCAGSO-UHFFFAOYSA-N.

Identity
Molecular formulaC16H32O2
Molecular weight256.42 g/mol
IUPAC name2,5-dimethyltetradecanoic acid
InChIKeyILOORJBAWCAGSO-UHFFFAOYSA-N
SMILESCCCCCCCCCC(C)CCC(C)C(=O)O

Computed by PubChem (NCBI)