CAS 22365-47-5 appears in our catalog under these names: Piperazine-1-carboxamidine hemisulfate, 95%, Piperazine-1-carboxamidine hemisulfate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
Bis(piperazine-1-carboximidamide);sulfuric acid (CAS 22365-47-5) is a chemical compound with the molecular formula C10H26N8O4S and a molecular weight of 354.43 g/mol. IUPAC name: bis(piperazine-1-carboximidamide);sulfuric acid. InChIKey: FKMYVONKCVRLGT-UHFFFAOYSA-N.
| Molecular formula | C10H26N8O4S |
|---|---|
| Molecular weight | 354.43 g/mol |
| IUPAC name | bis(piperazine-1-carboximidamide);sulfuric acid |
| InChIKey | FKMYVONKCVRLGT-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=N)N.C1CN(CCN1)C(=N)N.OS(=O)(=O)O |
Computed by PubChem (NCBI)