Products 223663-32-9
CAS 223663-32-9 appears in our catalog under these names: Collagen proline hydroxylase inhibitor-1/ 99.62% (existing batch purity), Collagen proline hydroxylase inhibitor-1. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 5 mg.
8-(4-benzylpiperazine-1-carbonyl)-3-nitro-1H-1,10-phenanthrolin-4-one (CAS 223663-32-9) is a chemical compound with the molecular formula C24H21N5O4 and a molecular weight of 443.5 g/mol. IUPAC name: 8-(4-benzylpiperazine-1-carbonyl)-3-nitro-1H-1,10-phenanthrolin-4-one. InChIKey: HPDVDDAVQSIBPH-UHFFFAOYSA-N.
| Molecular formula | C24H21N5O4 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | 8-(4-benzylpiperazine-1-carbonyl)-3-nitro-1H-1,10-phenanthrolin-4-one |
| InChIKey | HPDVDDAVQSIBPH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC2=CC=CC=C2)C(=O)C3=CN=C4C(=C3)C=CC5=C4NC=C(C5=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)