CAS 223668-68-6 appears in our catalog under these names: Dimethoxybis(pentafluorophenyl)silane, 95%, Bis(pentafluorophenyl)dimethoxysilane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 100g, 0,25g.
Dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane (CAS 223668-68-6) is a chemical compound with the molecular formula C14H6F10O2Si and a molecular weight of 424.26 g/mol. IUPAC name: dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane. InChIKey: OHLKTJUGGBHLLU-UHFFFAOYSA-N.
| Molecular formula | C14H6F10O2Si |
|---|---|
| Molecular weight | 424.26 g/mol |
| IUPAC name | dimethoxy-bis(2,3,4,5,6-pentafluorophenyl)silane |
| InChIKey | OHLKTJUGGBHLLU-UHFFFAOYSA-N |
| SMILES | CO[Si](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)OC |
Computed by PubChem (NCBI)