CAS 223674-40-6 is the registry number for Fmoc-Phe-Val-OH, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-methylbutanoic acid (CAS 223674-40-6) is a chemical compound with the molecular formula C29H30N2O5 and a molecular weight of 486.6 g/mol. IUPAC name: (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-methylbutanoic acid. InChIKey: XYCBNEVVTGBUTA-UIOOFZCWSA-N.
| Molecular formula | C29H30N2O5 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
| InChIKey | XYCBNEVVTGBUTA-UIOOFZCWSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)