Products 223686-91-7
CAS 223686-91-7 is the registry number for 1-((6,7-dimethoxy(3,4-dihydroisoquinolyl))methoxy)-2,4-dichlorobenzene. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg, 5000mg.
1-[(2,4-dichlorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline (CAS 223686-91-7) is a chemical compound with the molecular formula C18H17Cl2NO3 and a molecular weight of 366.2 g/mol. IUPAC name: 1-[(2,4-dichlorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline. InChIKey: SHYISVYUBCSHHT-UHFFFAOYSA-N.
| Molecular formula | C18H17Cl2NO3 |
|---|---|
| Molecular weight | 366.2 g/mol |
| IUPAC name | 1-[(2,4-dichlorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydroisoquinoline |
| InChIKey | SHYISVYUBCSHHT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCN=C2COC3=C(C=C(C=C3)Cl)Cl)OC |
Computed by PubChem (NCBI)